CAS 885524-57-2 appears in our catalog under these names: 5-Amino-2-ethoxy-N,N-dimethylbenzene-1-sulfonamide, 95%, 5-Amino-2-ethoxy-N,N-dimethylbenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
5-amino-2-ethoxy-N,N-dimethylbenzenesulfonamide (CAS 885524-57-2) is a chemical compound with the molecular formula C10H16N2O3S and a molecular weight of 244.31 g/mol. IUPAC name: 5-amino-2-ethoxy-N,N-dimethylbenzenesulfonamide. InChIKey: FHZGZOUIZGCREM-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O3S |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | 5-amino-2-ethoxy-N,N-dimethylbenzenesulfonamide |
| InChIKey | FHZGZOUIZGCREM-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)N)S(=O)(=O)N(C)C |
Computed by PubChem (NCBI)