CAS 885963-55-3 is the registry number for 2-Fluoro-N-hydroxy-6-methoxybenzimidamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-N'-hydroxy-6-methoxybenzenecarboximidamide (CAS 885963-55-3) is a chemical compound with the molecular formula C8H9FN2O2 and a molecular weight of 184.17 g/mol. IUPAC name: 2-fluoro-N'-hydroxy-6-methoxybenzenecarboximidamide. InChIKey: NUAMFEJESLRGQP-UHFFFAOYSA-N.
| Molecular formula | C8H9FN2O2 |
|---|---|
| Molecular weight | 184.17 g/mol |
| IUPAC name | 2-fluoro-N'-hydroxy-6-methoxybenzenecarboximidamide |
| InChIKey | NUAMFEJESLRGQP-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)F)C(=NO)N |
Computed by PubChem (NCBI)