CAS 886216-59-7 appears in our catalog under these names: (S)-2-Fluoro-1-phenylethanamine hydrochloride, 95+%, (S)-2-Fluoro-1-phenylethanamine HCl ee, (S)-2-Fluoro-1-phenylethanamine Hydrochloride, >97%, >97%, (S)-2-FLUORO-1-PHENYL-ETHYLAMINE HCL, >97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 0,5g, 50mg, 100mg, 250mg, 5g.
(1S)-2-fluoro-1-phenylethanamine;hydrochloride (CAS 886216-59-7) is a chemical compound with the molecular formula C8H11ClFN and a molecular weight of 175.63 g/mol. IUPAC name: (1S)-2-fluoro-1-phenylethanamine;hydrochloride. InChIKey: OLMLEABQOBEBQU-DDWIOCJRSA-N.
| Molecular formula | C8H11ClFN |
|---|---|
| Molecular weight | 175.63 g/mol |
| IUPAC name | (1S)-2-fluoro-1-phenylethanamine;hydrochloride |
| InChIKey | OLMLEABQOBEBQU-DDWIOCJRSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](CF)N.Cl |
Computed by PubChem (NCBI)