CAS 88628-54-0 is the registry number for 6-Methoxy-7-nitro-1,2,3,4-tetrahydronaphthalen-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-methoxy-7-nitro-3,4-dihydro-2H-naphthalen-1-one (CAS 88628-54-0) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 6-methoxy-7-nitro-3,4-dihydro-2H-naphthalen-1-one. InChIKey: KTIKLRGFDKNYST-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 6-methoxy-7-nitro-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | KTIKLRGFDKNYST-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CCCC2=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)