Products 886362-00-1
CAS 886362-00-1 appears in our catalog under these names: 3-Bromoimidazo[1,2-a]pyridine-6-carboxylic acid, 98%, 3-Bromoimidazo[1,2-a]pyridine-6-carboxylic acid, 95%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg.
3-bromoimidazo[1,2-a]pyridine-6-carboxylic acid (CAS 886362-00-1) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 3-bromoimidazo[1,2-a]pyridine-6-carboxylic acid. InChIKey: VLYJTINXFYEGOO-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 3-bromoimidazo[1,2-a]pyridine-6-carboxylic acid |
| InChIKey | VLYJTINXFYEGOO-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(N2C=C1C(=O)O)Br |
Computed by PubChem (NCBI)