Products 886368-66-7
CAS 886368-66-7 appears in our catalog under these names: 1–(3–Chlorophenyl)–2，2，2–trifluoroethylamine, 1-(3-Chlorophenyl)-2,2,2-trifluoroethylamine, 98%, 98%, 1-(3-Chlorophenyl)-2,2,2-trifluoroethylamine, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg.
1-(3-chlorophenyl)-2,2,2-trifluoroethanamine (CAS 886368-66-7) is a chemical compound with the molecular formula C8H7ClF3N and a molecular weight of 209.59 g/mol. IUPAC name: 1-(3-chlorophenyl)-2,2,2-trifluoroethanamine. InChIKey: VWKRJAXYSCHDKI-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3N |
|---|---|
| Molecular weight | 209.59 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-2,2,2-trifluoroethanamine |
| InChIKey | VWKRJAXYSCHDKI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(C(F)(F)F)N |
Computed by PubChem (NCBI)