CAS 1213627-66-7 is the registry number for (1R)-1-(3-Chlorophenyl)-2,2,2-trifluoroethylamine, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
(1R)-1-(3-chlorophenyl)-2,2,2-trifluoroethanamine (CAS 1213627-66-7) is a chemical compound with the molecular formula C8H7ClF3N and a molecular weight of 209.59 g/mol. IUPAC name: (1R)-1-(3-chlorophenyl)-2,2,2-trifluoroethanamine. InChIKey: VWKRJAXYSCHDKI-SSDOTTSWSA-N.
| Molecular formula | C8H7ClF3N |
|---|---|
| Molecular weight | 209.59 g/mol |
| IUPAC name | (1R)-1-(3-chlorophenyl)-2,2,2-trifluoroethanamine |
| InChIKey | VWKRJAXYSCHDKI-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)[C@H](C(F)(F)F)N |
Computed by PubChem (NCBI)