CAS 886370-54-3 is the registry number for 1–(2–Chlorophenyl)–2,2,2–trifluoroethanamine. Offered by: GLPBio. Available pack sizes: 100mg.
1-(2-chlorophenyl)-2,2,2-trifluoroethanamine (CAS 886370-54-3) is a chemical compound with the molecular formula C8H7ClF3N and a molecular weight of 209.59 g/mol. IUPAC name: 1-(2-chlorophenyl)-2,2,2-trifluoroethanamine. InChIKey: DLIXGNJUPCBBER-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3N |
|---|---|
| Molecular weight | 209.59 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-2,2,2-trifluoroethanamine |
| InChIKey | DLIXGNJUPCBBER-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(F)(F)F)N)Cl |
Computed by PubChem (NCBI)