Products 886497-19-4
CAS 886497-19-4 appears in our catalog under these names: 3'-Chloro-5'-fluoro-4'-methoxyacetophenone, 95%, 3'-Chloro-5'-fluoro-4'-methoxyacetophenone, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g.
1-(3-chloro-5-fluoro-4-methoxyphenyl)ethanone (CAS 886497-19-4) is a chemical compound with the molecular formula C9H8ClFO2 and a molecular weight of 202.61 g/mol. IUPAC name: 1-(3-chloro-5-fluoro-4-methoxyphenyl)ethanone. InChIKey: NRCCXQQIBNFBRT-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO2 |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | 1-(3-chloro-5-fluoro-4-methoxyphenyl)ethanone |
| InChIKey | NRCCXQQIBNFBRT-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C(=C1)Cl)OC)F |
Computed by PubChem (NCBI)