CAS 886497-35-4 is the registry number for 5-(3-Methoxyphenyl)-1,2,4-triazin-3-amine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
5-(3-methoxyphenyl)-1,2,4-triazin-3-amine (CAS 886497-35-4) is a chemical compound with the molecular formula C10H10N4O and a molecular weight of 202.21 g/mol. IUPAC name: 5-(3-methoxyphenyl)-1,2,4-triazin-3-amine. InChIKey: TYLBPNRQFRHVNH-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 5-(3-methoxyphenyl)-1,2,4-triazin-3-amine |
| InChIKey | TYLBPNRQFRHVNH-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CN=NC(=N2)N |
Computed by PubChem (NCBI)