Products 886498-65-3
CAS 886498-65-3 appears in our catalog under these names: 2,6-Difluoro-3-methoxyphenylacetic acid, 95%, 2,6-Difluoro-3-methoxyphenylacetic acid, 97% , 2,6-Difluoro-3-methoxyphenylacetic acid, 97%(LC-MS),RG, 97%(LC-MS),RG, 2,6-Difluoro-3-methoxyphenylacetic acid, 97%(LC-MS),RG. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 250mg , 100mg, 5g.
2-(2,6-difluoro-3-methoxyphenyl)acetic acid (CAS 886498-65-3) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: 2-(2,6-difluoro-3-methoxyphenyl)acetic acid. InChIKey: KIUMRKHFRAIFFF-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O3 |
|---|---|
| Molecular weight | 202.15 g/mol |
| IUPAC name | 2-(2,6-difluoro-3-methoxyphenyl)acetic acid |
| InChIKey | KIUMRKHFRAIFFF-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)F)CC(=O)O)F |
Computed by PubChem (NCBI)