Products 886499-74-7
CAS 886499-74-7 appears in our catalog under these names: 3-(4-(trifluoromethoxy)phenyl)propanoicacid, 3-(4-(Trifluoromethoxy)phenyl)propanoic acid, 98%, 98%, 3-(4-(Trifluoromethoxy)phenyl)propanoic acid, 98%, 3-[4-(Trifluoromethoxy)phenyl]propionic acid, 98%. Offered by: Biosynth, Chemat, Ambeed, Fluorochem, BLDpharm. Available pack sizes: 50g, 25g, 100g, 250g, 1g, 5g.
3-[4-(trifluoromethoxy)phenyl]propanoic acid (CAS 886499-74-7) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: 3-[4-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: RRPISZJLUXOOCL-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | 3-[4-(trifluoromethoxy)phenyl]propanoic acid |
| InChIKey | RRPISZJLUXOOCL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCC(=O)O)OC(F)(F)F |
Computed by PubChem (NCBI)