Products 886500-31-8
CAS 886500-31-8 appears in our catalog under these names: 2-Chloro-6-(trifluoromethyl)phenylacetic acid, 95%, 2-(2-Chloro-6-(trifluoromethyl)phenyl)acetic acid, 98%, 2–Chloro–6–(Trifluoromethyl)Phenylacetic Acid, 2-Chloro-6-(trifluoromethyl)phenylacetic acid, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
2-[2-chloro-6-(trifluoromethyl)phenyl]acetic acid (CAS 886500-31-8) is a chemical compound with the molecular formula C9H6ClF3O2 and a molecular weight of 238.59 g/mol. IUPAC name: 2-[2-chloro-6-(trifluoromethyl)phenyl]acetic acid. InChIKey: QVSWFQSUELDCNS-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O2 |
|---|---|
| Molecular weight | 238.59 g/mol |
| IUPAC name | 2-[2-chloro-6-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | QVSWFQSUELDCNS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)