CAS 886503-70-4 appears in our catalog under these names: 2,3-Difluoro-4-methoxyphenylacetic acid, 2,3-Difluoro-4-methoxyphenylacetic acid, 95%, 2–(2,3–Difluoro–4–methoxyphenyl)acetic acid. Offered by: Biosynth, Combi-blocks, GLPBio. Available pack sizes: 2,5g, 250mg, 5g, 1g, 100mg.
2-(2,3-difluoro-4-methoxyphenyl)acetic acid (CAS 886503-70-4) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: 2-(2,3-difluoro-4-methoxyphenyl)acetic acid. InChIKey: BURJSULJPCCRLL-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O3 |
|---|---|
| Molecular weight | 202.15 g/mol |
| IUPAC name | 2-(2,3-difluoro-4-methoxyphenyl)acetic acid |
| InChIKey | BURJSULJPCCRLL-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)CC(=O)O)F)F |
Computed by PubChem (NCBI)