CAS 886503-97-5 is the registry number for 3-Bromo-2-hydroxy-4,5-dimethylbenzaldehyde, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3-bromo-2-hydroxy-4,5-dimethylbenzaldehyde (CAS 886503-97-5) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 3-bromo-2-hydroxy-4,5-dimethylbenzaldehyde. InChIKey: DVPXMTLVGIGHEO-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 3-bromo-2-hydroxy-4,5-dimethylbenzaldehyde |
| InChIKey | DVPXMTLVGIGHEO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)Br)O)C=O |
Computed by PubChem (NCBI)