CAS 887-15-0 is the registry number for 2,2-Diphenyltetrahydrofuran, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-diphenyloxolane (CAS 887-15-0) is a chemical compound with the molecular formula C16H16O and a molecular weight of 224.30 g/mol. IUPAC name: 2,2-diphenyloxolane. InChIKey: ONRSPOWNRLCCGF-UHFFFAOYSA-N.
| Molecular formula | C16H16O |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | 2,2-diphenyloxolane |
| InChIKey | ONRSPOWNRLCCGF-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)