CAS 887350-80-3 appears in our catalog under these names: 2-Methyl-5-(methylsulfonyl)pyrimidin-4-amine, 98%, 98%, 2-METHYL-5-(METHYLSULFONYL)PYRIMIDIN-4-AMINE, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg.
2-methyl-5-methylsulfonylpyrimidin-4-amine (CAS 887350-80-3) is a chemical compound with the molecular formula C6H9N3O2S and a molecular weight of 187.22 g/mol. IUPAC name: 2-methyl-5-methylsulfonylpyrimidin-4-amine. InChIKey: HVPLAACTIPZDSR-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O2S |
|---|---|
| Molecular weight | 187.22 g/mol |
| IUPAC name | 2-methyl-5-methylsulfonylpyrimidin-4-amine |
| InChIKey | HVPLAACTIPZDSR-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C(=N1)N)S(=O)(=O)C |
Computed by PubChem (NCBI)