CAS 887407-00-3 is the registry number for 2-(3-Chlorobenzyl)benzaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3-chlorophenyl)methyl]benzaldehyde (CAS 887407-00-3) is a chemical compound with the molecular formula C14H11ClO and a molecular weight of 230.69 g/mol. IUPAC name: 2-[(3-chlorophenyl)methyl]benzaldehyde. InChIKey: NCXXJQPCIPTHSA-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 2-[(3-chlorophenyl)methyl]benzaldehyde |
| InChIKey | NCXXJQPCIPTHSA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC2=CC(=CC=C2)Cl)C=O |
Computed by PubChem (NCBI)