CAS 88753-04-2 is the registry number for 4-(Dimethylamino)-2,5-dimethoxybenzaldehyde, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(dimethylamino)-2,5-dimethoxybenzaldehyde (CAS 88753-04-2) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: 4-(dimethylamino)-2,5-dimethoxybenzaldehyde. InChIKey: AOVGDTNZLIVEDJ-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 4-(dimethylamino)-2,5-dimethoxybenzaldehyde |
| InChIKey | AOVGDTNZLIVEDJ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C(=C1)OC)C=O)OC |
Computed by PubChem (NCBI)