Products 887913-68-0
CAS 887913-68-0 is the registry number for Methyl 2-(3-bromophenyl)-2-{((tert-butoxy)carbonyl)amino}propanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 2-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 887913-68-0) is a chemical compound with the molecular formula C15H20BrNO4 and a molecular weight of 358.23 g/mol. IUPAC name: methyl 2-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: BNIAMYBAFNIUOA-UHFFFAOYSA-N.
| Molecular formula | C15H20BrNO4 |
|---|---|
| Molecular weight | 358.23 g/mol |
| IUPAC name | methyl 2-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | BNIAMYBAFNIUOA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C1=CC(=CC=C1)Br)C(=O)OC |
Computed by PubChem (NCBI)