Products 887976-19-4
CAS 887976-19-4 is the registry number for 6-(3-Chlorophenyl)nicotinic acid, ≥95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-(3-chlorophenyl)pyridine-3-carboxylic acid (CAS 887976-19-4) is a chemical compound with the molecular formula C12H8ClNO2 and a molecular weight of 233.65 g/mol. IUPAC name: 6-(3-chlorophenyl)pyridine-3-carboxylic acid. InChIKey: NWBCIKJWYVAJLJ-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO2 |
|---|---|
| Molecular weight | 233.65 g/mol |
| IUPAC name | 6-(3-chlorophenyl)pyridine-3-carboxylic acid |
| InChIKey | NWBCIKJWYVAJLJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)