CAS 88807-84-5 appears in our catalog under these names: 5-Methyl-5-(2-methylphenyl)imidazolidine-2,4-dione, 5-Methyl-5-(2-methylphenyl)imidazolidine-2,4-dione, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 2,5g, 250mg, 5g.
5-methyl-5-(2-methylphenyl)imidazolidine-2,4-dione (CAS 88807-84-5) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: 5-methyl-5-(2-methylphenyl)imidazolidine-2,4-dione. InChIKey: ISQYMAJQGFCFJW-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 5-methyl-5-(2-methylphenyl)imidazolidine-2,4-dione |
| InChIKey | ISQYMAJQGFCFJW-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2(C(=O)NC(=O)N2)C |
Computed by PubChem (NCBI)