Products 888324-08-1
CAS 888324-08-1 is the registry number for 1-(tert-butyl) 2-methyl (S)-4-methylene-5-oxopyrrolidine-1,2-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
1-O-tert-butyl 2-O-methyl (2S)-4-methylidene-5-oxopyrrolidine-1,2-dicarboxylate (CAS 888324-08-1) is a chemical compound with the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-4-methylidene-5-oxopyrrolidine-1,2-dicarboxylate. InChIKey: SEKQUVJKLFLHKW-QMMMGPOBSA-N.
| Molecular formula | C12H17NO5 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-4-methylidene-5-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | SEKQUVJKLFLHKW-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](CC(=C)C1=O)C(=O)OC |
Computed by PubChem (NCBI)