Products 88958-15-0
CAS 88958-15-0 is the registry number for ethyl 5-(p-tolyl)isoxazole-3-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
Ethyl 5-(4-methylphenyl)-1,2-oxazole-3-carboxylate (CAS 88958-15-0) is a chemical compound with the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. IUPAC name: ethyl 5-(4-methylphenyl)-1,2-oxazole-3-carboxylate. InChIKey: XPIUEGYFYXHZBH-UHFFFAOYSA-N.
| Molecular formula | C13H13NO3 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | ethyl 5-(4-methylphenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | XPIUEGYFYXHZBH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)