CAS 88965-93-9 appears in our catalog under these names: Econazole Impurity 6, (±)-2-(2,4-Dichlorophenyl)-2-hydroxyethylamine, (±)-2-(2,4-Dichlorophenyl)-2-hydroxyethylamine. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 250mg, 25mg, 2,5g.
2-amino-1-(2,4-dichlorophenyl)ethanol (CAS 88965-93-9) is a chemical compound with the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. IUPAC name: 2-amino-1-(2,4-dichlorophenyl)ethanol. InChIKey: WTTIEVRVCBIEQJ-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | 2-amino-1-(2,4-dichlorophenyl)ethanol |
| InChIKey | WTTIEVRVCBIEQJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(CN)O |
Computed by PubChem (NCBI)