CAS 889764-50-5 is the registry number for 1-(Benzo[d]thiazol-2-yl)-2-phenylethan-1-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(1,3-benzothiazol-2-yl)-2-phenylethanamine (CAS 889764-50-5) is a chemical compound with the molecular formula C15H14N2S and a molecular weight of 254.4 g/mol. IUPAC name: 1-(1,3-benzothiazol-2-yl)-2-phenylethanamine. InChIKey: PNSYMFALJUIRBH-UHFFFAOYSA-N.
| Molecular formula | C15H14N2S |
|---|---|
| Molecular weight | 254.4 g/mol |
| IUPAC name | 1-(1,3-benzothiazol-2-yl)-2-phenylethanamine |
| InChIKey | PNSYMFALJUIRBH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C2=NC3=CC=CC=C3S2)N |
Computed by PubChem (NCBI)