CAS 889813-26-7 appears in our catalog under these names: 2-Benzylimidazo(1,2-a)pyridine, 95%, 2-Benzylimidazo(1,2-a)pyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-benzylimidazo[1,2-a]pyridine (CAS 889813-26-7) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 2-benzylimidazo[1,2-a]pyridine. InChIKey: BOYDQUIVNHEZFN-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 2-benzylimidazo[1,2-a]pyridine |
| InChIKey | BOYDQUIVNHEZFN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CN3C=CC=CC3=N2 |
Computed by PubChem (NCBI)