CAS 889942-43-2 appears in our catalog under these names: 3-(4-Carboxyphenyl)piperidine hydrochloride, 95%, 4-(3-Piperidinyl)benzoic Acid. Offered by: Combi-blocks, TRC. Available pack sizes: 10g, 1g, 5g, 250mg, 500mg.
4-piperidin-3-ylbenzoic acid (CAS 889942-43-2) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 4-piperidin-3-ylbenzoic acid. InChIKey: CBQKKABCNQVVOP-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 4-piperidin-3-ylbenzoic acid |
| InChIKey | CBQKKABCNQVVOP-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)