CAS 890010-89-6 appears in our catalog under these names: 1-(3,5-Dimethylphenyl)-3-methyl-1h-pyrazol-5-amine, 95%, 1-(3,5-Dimethylphenyl)-3-methyl-1H-pyrazol-5-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 2,5g.
2-(3,5-dimethylphenyl)-5-methylpyrazol-3-amine (CAS 890010-89-6) is a chemical compound with the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. IUPAC name: 2-(3,5-dimethylphenyl)-5-methylpyrazol-3-amine. InChIKey: ZKWCQOGKTAHXKC-UHFFFAOYSA-N.
| Molecular formula | C12H15N3 |
|---|---|
| Molecular weight | 201.27 g/mol |
| IUPAC name | 2-(3,5-dimethylphenyl)-5-methylpyrazol-3-amine |
| InChIKey | ZKWCQOGKTAHXKC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)N2C(=CC(=N2)C)N)C |
Computed by PubChem (NCBI)