CAS 890095-80-4 appears in our catalog under these names: 3-(2H-1,3-Benzodioxol-5-yl)-5-(chloromethyl)-1,2,4-oxadiazole, 95%, 3-(1,3-Dioxaindan-5-yl)-5-(chloromethyl)-1,2,4-oxadiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
3-(1,3-benzodioxol-5-yl)-5-(chloromethyl)-1,2,4-oxadiazole (CAS 890095-80-4) is a chemical compound with the molecular formula C10H7ClN2O3 and a molecular weight of 238.63 g/mol. IUPAC name: 3-(1,3-benzodioxol-5-yl)-5-(chloromethyl)-1,2,4-oxadiazole. InChIKey: VVLQMOKXVARULQ-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O3 |
|---|---|
| Molecular weight | 238.63 g/mol |
| IUPAC name | 3-(1,3-benzodioxol-5-yl)-5-(chloromethyl)-1,2,4-oxadiazole |
| InChIKey | VVLQMOKXVARULQ-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=NOC(=N3)CCl |
Computed by PubChem (NCBI)