Products 890301-91-4
CAS 890301-91-4 appears in our catalog under these names: 2-(Trifluoromethyl)-1,6-naphthyridin-5(6H)-one, 97%, 97%, 2-(Trifluoromethyl)-1,6-naphthyridin-5(6H)-one, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2-(trifluoromethyl)-6H-1,6-naphthyridin-5-one (CAS 890301-91-4) is a chemical compound with the molecular formula C9H5F3N2O and a molecular weight of 214.14 g/mol. IUPAC name: 2-(trifluoromethyl)-6H-1,6-naphthyridin-5-one. InChIKey: NAUGQCJDSOPFLF-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2O |
|---|---|
| Molecular weight | 214.14 g/mol |
| IUPAC name | 2-(trifluoromethyl)-6H-1,6-naphthyridin-5-one |
| InChIKey | NAUGQCJDSOPFLF-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C(=O)NC=C2)C(F)(F)F |
Computed by PubChem (NCBI)