Products 89038-93-7
CAS 89038-93-7 appears in our catalog under these names: 5-Bromo-3H-spiro[benzofuran-2,4'-piperidine] hydrochloride 95%, 5-Bromo-3H-spiro[benzofuran-2,4'-piperidine] hydrochloride, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromospiro[3H-1-benzofuran-2,4'-piperidine];hydrochloride (CAS 89038-93-7) is a chemical compound with the molecular formula C12H15BrClNO and a molecular weight of 304.61 g/mol. IUPAC name: 5-bromospiro[3H-1-benzofuran-2,4'-piperidine];hydrochloride. InChIKey: CSOYKYFWLYERHO-UHFFFAOYSA-N.
| Molecular formula | C12H15BrClNO |
|---|---|
| Molecular weight | 304.61 g/mol |
| IUPAC name | 5-bromospiro[3H-1-benzofuran-2,4'-piperidine];hydrochloride |
| InChIKey | CSOYKYFWLYERHO-UHFFFAOYSA-N |
| SMILES | C1CNCCC12CC3=C(O2)C=CC(=C3)Br.Cl |
Computed by PubChem (NCBI)