Products 890621-13-3

CAS 890621-13-3 is the registry number for 3-(2-Chlorophenyl)-1H-pyrazole-5-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(2-chlorophenyl)-1H-pyrazole-5-carboxylic acid (CAS 890621-13-3) is a chemical compound with the molecular formula C10H7ClN2O2 and a molecular weight of 222.63 g/mol. IUPAC name: 3-(2-chlorophenyl)-1H-pyrazole-5-carboxylic acid. InChIKey: YECLPKDINYXXNB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7ClN2O2
Molecular weight222.63 g/mol
IUPAC name3-(2-chlorophenyl)-1H-pyrazole-5-carboxylic acid
InChIKeyYECLPKDINYXXNB-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=NNC(=C2)C(=O)O)Cl

Computed by PubChem (NCBI)