Products 89102-54-5
CAS 89102-54-5 is the registry number for 4-(2-Bromoacetyl)-N,N-dimethylbenzenesulfonamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-(2-bromoacetyl)-N,N-dimethylbenzenesulfonamide (CAS 89102-54-5) is a chemical compound with the molecular formula C10H12BrNO3S and a molecular weight of 306.18 g/mol. IUPAC name: 4-(2-bromoacetyl)-N,N-dimethylbenzenesulfonamide. InChIKey: GPRFNTIBFADUHF-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO3S |
|---|---|
| Molecular weight | 306.18 g/mol |
| IUPAC name | 4-(2-bromoacetyl)-N,N-dimethylbenzenesulfonamide |
| InChIKey | GPRFNTIBFADUHF-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=C(C=C1)C(=O)CBr |
Computed by PubChem (NCBI)