CAS 89108-63-4 appears in our catalog under these names: 3-Allyl-4-hydroxy-1-phenyl-1,8-naphthyridin-2(1h)-one, 95%, 3-Allyl-4-hydroxy-1-phenyl-1,8-naphthyridin-2(1H)-one, 97%, 3–allyl–4–hydroxy–1–phenyl–1,8–naphthyridin–2(1H)–one. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
4-hydroxy-1-phenyl-3-prop-2-enyl-1,8-naphthyridin-2-one (CAS 89108-63-4) is a chemical compound with the molecular formula C17H14N2O2 and a molecular weight of 278.30 g/mol. IUPAC name: 4-hydroxy-1-phenyl-3-prop-2-enyl-1,8-naphthyridin-2-one. InChIKey: DHSUHPJUEBYIIS-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O2 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 4-hydroxy-1-phenyl-3-prop-2-enyl-1,8-naphthyridin-2-one |
| InChIKey | DHSUHPJUEBYIIS-UHFFFAOYSA-N |
| SMILES | C=CCC1=C(C2=C(N=CC=C2)N(C1=O)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)