CAS 89185-45-5 appears in our catalog under these names: 7-Methyl-2-phenylimidazo(1,2-a)pyridin-3-amine, 97%, 7-Methyl-2-phenylimidazo(1,2-a)pyridin-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 2,5g, 250mg.
7-methyl-2-phenylimidazo[1,2-a]pyridin-3-amine (CAS 89185-45-5) is a chemical compound with the molecular formula C14H13N3 and a molecular weight of 223.27 g/mol. IUPAC name: 7-methyl-2-phenylimidazo[1,2-a]pyridin-3-amine. InChIKey: FBFCRKNRKASWEW-UHFFFAOYSA-N.
| Molecular formula | C14H13N3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 7-methyl-2-phenylimidazo[1,2-a]pyridin-3-amine |
| InChIKey | FBFCRKNRKASWEW-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC(=C(N2C=C1)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)