Products 89210-31-1
CAS 89210-31-1 is the registry number for 2-(Bromomethyl)-1,3-dimethyl-5-nitrobenzene, 97%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
2-(bromomethyl)-1,3-dimethyl-5-nitrobenzene (CAS 89210-31-1) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: 2-(bromomethyl)-1,3-dimethyl-5-nitrobenzene. InChIKey: WKMKJIXIVRQQRU-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | 2-(bromomethyl)-1,3-dimethyl-5-nitrobenzene |
| InChIKey | WKMKJIXIVRQQRU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1CBr)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)