CAS 893616-55-2 is the registry number for Methyl 2,4–dihydroxy–6–methylnicotinate. Offered by: GLPBio. Available pack sizes: 250mg.
Methyl 4-hydroxy-6-methyl-2-oxo-1H-pyridine-3-carboxylate (CAS 893616-55-2) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: methyl 4-hydroxy-6-methyl-2-oxo-1H-pyridine-3-carboxylate. InChIKey: VXGARFACKOZQCP-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | methyl 4-hydroxy-6-methyl-2-oxo-1H-pyridine-3-carboxylate |
| InChIKey | VXGARFACKOZQCP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=O)N1)C(=O)OC)O |
Computed by PubChem (NCBI)