Products 893638-41-0
CAS 893638-41-0 appears in our catalog under these names: 5-(Pyridin-4-yl)-1,2-oxazole-3-carboxylic acid, 97%, 5-(4-Pyridyl)isoxazole-3-carboxylic Acid, 98%, 5–(4–Pyridyl)isoxazole–3–carboxylic Acid, 5-(Pyridin-4-yl)-1,2-oxazole-3-carboxylic acid, 5-(Pyridin-4-yl)isoxazole-3-carboxylic acid, >97%, >97%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 10g, 5g, 250mg, 2,5g, 100mg.
5-pyridin-4-yl-1,2-oxazole-3-carboxylic acid (CAS 893638-41-0) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 5-pyridin-4-yl-1,2-oxazole-3-carboxylic acid. InChIKey: HTIKJHQMKVJKCZ-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 5-pyridin-4-yl-1,2-oxazole-3-carboxylic acid |
| InChIKey | HTIKJHQMKVJKCZ-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)