CAS 893643-33-9 appears in our catalog under these names: Ethyl 4-cyclohexyl-2,4-dioxobutanoate, 98%, Ethyl 4-cyclohexyl-2,4-dioxobutanoate, Ethyl 4-cyclohexyl-2,4-dioxobutanoate, 97%, 97%, ethyl 4-cyclohexyl-2-hydroxy-4-oxobut-2-enoate, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 50mg, 250mg, 500mg, 2.5g, 10g.
Ethyl 4-cyclohexyl-2,4-dioxobutanoate (CAS 893643-33-9) is a chemical compound with the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. IUPAC name: ethyl 4-cyclohexyl-2,4-dioxobutanoate. InChIKey: AENZJLQZKJPTQT-UHFFFAOYSA-N.
| Molecular formula | C12H18O4 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | ethyl 4-cyclohexyl-2,4-dioxobutanoate |
| InChIKey | AENZJLQZKJPTQT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C1CCCCC1 |
Computed by PubChem (NCBI)