CAS 89384-51-0 appears in our catalog under these names: (S)–2–(Benzylamino)–4–methylpentanoic acid, Bzl-Leu-OH 98%, (S)-2-(Benzylamino)-4-methylpentanoic acid, 98%, 98%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg.
(2S)-2-(benzylamino)-4-methylpentanoic acid (CAS 89384-51-0) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: (2S)-2-(benzylamino)-4-methylpentanoic acid. InChIKey: ZJOWTIPPMQBTTA-LBPRGKRZSA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | (2S)-2-(benzylamino)-4-methylpentanoic acid |
| InChIKey | ZJOWTIPPMQBTTA-LBPRGKRZSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NCC1=CC=CC=C1 |
Computed by PubChem (NCBI)