CAS 89399-21-3 is the registry number for N-N-Hexyl-4-nitrobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-hexyl-4-nitrobenzamide (CAS 89399-21-3) is a chemical compound with the molecular formula C13H18N2O3 and a molecular weight of 250.29 g/mol. IUPAC name: N-hexyl-4-nitrobenzamide. InChIKey: YIQCYVHPIUGJKJ-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O3 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | N-hexyl-4-nitrobenzamide |
| InChIKey | YIQCYVHPIUGJKJ-UHFFFAOYSA-N |
| SMILES | CCCCCCNC(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)