CAS 89483-08-9 appears in our catalog under these names: Boc-d-cyclopropylalanine, 95%, (R)-2-((tert-Butoxycarbonyl)amino)-3-cyclopropylpropanoic acid, 95%, Boc-D-Ala(cPr)-OH 95%, (αR)-α-[[(1,1-Dimethylethoxy)carbonyl]amino]cyclopropanepropanoic acid, 95%, 95%, (R)-2-(BOC-AMINO)-3-CYCLOPROPYLPROPANOIC ACID, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
(2R)-3-cyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 89483-08-9) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: (2R)-3-cyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: GKRRTFCDSZGFSZ-MRVPVSSYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | (2R)-3-cyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | GKRRTFCDSZGFSZ-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1CC1)C(=O)O |
Computed by PubChem (NCBI)