CAS 89496-02-6 appears in our catalog under these names: (R)-2-Amino-3-(5-methoxy-1h-indol-3-yl)propanoic acid, 95%, (R)–2–Amino–3–(5–methoxy–1H–indol–3–yl)propanoic acid, (R)-2-Amino-3-(5-methoxy-1H-indol-3-yl)propanoic acid, 95%, 95%, H-D-Trp(5-OMe)-OH, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 25mg, 50mg, 100mg, 5g.
(2R)-2-amino-3-(5-methoxy-1H-indol-3-yl)propanoic acid (CAS 89496-02-6) is a chemical compound with the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. IUPAC name: (2R)-2-amino-3-(5-methoxy-1H-indol-3-yl)propanoic acid. InChIKey: KVNPSKDDJARYKK-SNVBAGLBSA-N.
| Molecular formula | C12H14N2O3 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | (2R)-2-amino-3-(5-methoxy-1H-indol-3-yl)propanoic acid |
| InChIKey | KVNPSKDDJARYKK-SNVBAGLBSA-N |
| SMILES | COC1=CC2=C(C=C1)NC=C2C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)