CAS 895543-00-7 appears in our catalog under these names: Trifarotene Impurity 6, (3-(tert-Butyl)-4-(pyrrolidin-1-yl)phenyl)boronic acid 95%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 1g, 250mg.
(3-tert-butyl-4-pyrrolidin-1-ylphenyl)boronic acid (CAS 895543-00-7) is a chemical compound with the molecular formula C14H22BNO2 and a molecular weight of 247.14 g/mol. IUPAC name: (3-tert-butyl-4-pyrrolidin-1-ylphenyl)boronic acid. InChIKey: QAPKAEMTJUVEKT-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO2 |
|---|---|
| Molecular weight | 247.14 g/mol |
| IUPAC name | (3-tert-butyl-4-pyrrolidin-1-ylphenyl)boronic acid |
| InChIKey | QAPKAEMTJUVEKT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)N2CCCC2)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)