Products 89613-32-1
CAS 89613-32-1 appears in our catalog under these names: Dodecanedioic-d20 Acid, >95% (HPLC), 1,12-Dodecanedioic-d20 Acid, 98 atom % D, min 98% Chemical Purity, Dodecanedioic acid–d20, Dodecanedioic acid-d20, 99.0%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 50mg, 0,25g, 0,1g, 10mg, 25mg, 5mg, 50 mg, 100 mg.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosadeuteriododecanedioic acid (CAS 89613-32-1) is a chemical compound with the molecular formula C12H22O4 and a molecular weight of 250.42 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosadeuteriododecanedioic acid. InChIKey: TVIDDXQYHWJXFK-KHKAULECSA-N.
| Molecular formula | C12H22O4 |
|---|---|
| Molecular weight | 250.42 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosadeuteriododecanedioic acid |
| InChIKey | TVIDDXQYHWJXFK-KHKAULECSA-N |
| SMILES | [2H]C([2H])(C(=O)O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
Computed by PubChem (NCBI)