Products 97543-02-7
CAS 97543-02-7 appears in our catalog under these names: 1,12-Dodecanedioic-2,2,11,11-d4 Acid, 98 atom % D, min 98% Chemical Purity, Dodecanedioic acid–d4, Dodecanedioic acid-d4, 99.95%, 1,12-Dodecanedioic-2,2,11,11-d4 acid, min. 95 %, 25 mg, 1,12-Dodecanedioic-2,2,11,11-d4 acid, min. 95 %, 50 mg. Offered by: CDN, GLPBio, MedChemExpress, Roth. Available pack sizes: 1g, 0,5g, 10mg, 100mg, 25mg, 50mg, 50 mg, 5 mg.
2,2,11,11-tetradeuteriododecanedioic acid (CAS 97543-02-7) is a chemical compound with the molecular formula C12H22O4 and a molecular weight of 234.32 g/mol. IUPAC name: 2,2,11,11-tetradeuteriododecanedioic acid. InChIKey: TVIDDXQYHWJXFK-YQUBHJMPSA-N.
| Molecular formula | C12H22O4 |
|---|---|
| Molecular weight | 234.32 g/mol |
| IUPAC name | 2,2,11,11-tetradeuteriododecanedioic acid |
| InChIKey | TVIDDXQYHWJXFK-YQUBHJMPSA-N |
| SMILES | [2H]C([2H])(CCCCCCCCC([2H])([2H])C(=O)O)C(=O)O |
Computed by PubChem (NCBI)