CAS 89655-70-9 appears in our catalog under these names: 2-(3,4-Dichlorophenyl)-2-methylpropan-1-amine, 95%, 2-(3,4-Dichlorophenyl)-2-methylpropan-1-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2-(3,4-dichlorophenyl)-2-methylpropan-1-amine (CAS 89655-70-9) is a chemical compound with the molecular formula C10H13Cl2N and a molecular weight of 218.12 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-2-methylpropan-1-amine. InChIKey: MSZDVAOFDODOOY-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N |
|---|---|
| Molecular weight | 218.12 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-2-methylpropan-1-amine |
| InChIKey | MSZDVAOFDODOOY-UHFFFAOYSA-N |
| SMILES | CC(C)(CN)C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)