Products 897400-05-4

CAS 897400-05-4 is the registry number for Ethyl 3-((3-Methoxy-2-methyl-3-oxopropyl)(methyl)amino)butanoate. Offered by: TRC. Available pack sizes: 1g, 2,5g, 500mg.

Structural formula: {0} (CAS {1})

Ethyl 3-[(3-methoxy-2-methyl-3-oxopropyl)-methylamino]butanoate (CAS 897400-05-4) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: ethyl 3-[(3-methoxy-2-methyl-3-oxopropyl)-methylamino]butanoate. InChIKey: OYKRWXQXIRNHKQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H23NO4
Molecular weight245.32 g/mol
IUPAC nameethyl 3-[(3-methoxy-2-methyl-3-oxopropyl)-methylamino]butanoate
InChIKeyOYKRWXQXIRNHKQ-UHFFFAOYSA-N
SMILESCCOC(=O)CC(C)N(C)CC(C)C(=O)OC

Computed by PubChem (NCBI)