CAS 89781-55-5 is the registry number for Rolafagrel. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxylic acid (CAS 89781-55-5) is a chemical compound with the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. IUPAC name: 7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxylic acid. InChIKey: DQEDSIVMYUUZCK-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxylic acid |
| InChIKey | DQEDSIVMYUUZCK-UHFFFAOYSA-N |
| SMILES | C1CC(=CC2=C1C=CC(=C2)C(=O)O)N3C=CN=C3 |
Computed by PubChem (NCBI)